C27H30N2O6 — CID 21224448
4-[6-[3-methoxy-4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]hexyl]-1,3-oxazolidine-2,5-dione (PubChem CID 21224448) has the molecular formula C27H30N2O6 and a molecular weight of 478.55 g/mol. Its IUPAC name is 4-[6-[3-methoxy-4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]hexyl]-1,3-oxazolidine-2,5-dione.
| Compound Name | 4-[6-[3-methoxy-4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]hexyl]-1,3-oxazolidine-2,5-dione |
|---|---|
| PubChem CID | 21224448 |
| Molecular Formula | C27H30N2O6 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | 4-[6-[3-methoxy-4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]hexyl]-1,3-oxazolidine-2,5-dione |
| SMILES | COc1cc(CCCCCCC2NC(=O)OC2=O)ccc1OCc1nc(-c2ccccc2)oc1C |
| InChI | InChI=1S/C27H30N2O6/c1-18-22(28-25(34-18)20-11-7-5-8-12-20)17-33-23-15-14-19(16-24(23)32-2)10-6-3-4-9-13-21-26(30)35-27(31)29-21/h5,7-8,11-12,14-16,21H,3-4,6,9-10,13,17H2,1-2H3,(H,29,31) |
| InChIKey | ZFUDYCYOMUHRJT-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 99.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|