C26H28N2O5 — CID 18546152
4-[5-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]pentyl]-1,3-oxazolidine-2,5-dione (PubChem CID 18546152) has the molecular formula C26H28N2O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is 4-[5-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]pentyl]-1,3-oxazolidine-2,5-dione.
| Compound Name | 4-[5-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]pentyl]-1,3-oxazolidine-2,5-dione |
|---|---|
| PubChem CID | 18546152 |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 4-[5-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]pentyl]-1,3-oxazolidine-2,5-dione |
| SMILES | Cc1oc(-c2ccccc2)nc1CCOc1ccc(CCCCCC2NC(=O)OC2=O)cc1 |
| InChI | InChI=1S/C26H28N2O5/c1-18-22(27-24(32-18)20-9-5-3-6-10-20)16-17-31-21-14-12-19(13-15-21)8-4-2-7-11-23-25(29)33-26(30)28-23/h3,5-6,9-10,12-15,23H,2,4,7-8,11,16-17H2,1H3,(H,28,30) |
| InChIKey | ZIOCWROIUTXHAP-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|