C29H30N2O4 — CID 154053953
2-[[3-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]propylamino]methyl]benzoic acid (PubChem CID 154053953) has the molecular formula C29H30N2O4 and a molecular weight of 470.57 g/mol. Its IUPAC name is 2-[[3-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]propylamino]methyl]benzoic acid.
| Compound Name | 2-[[3-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]propylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 154053953 |
| Molecular Formula | C29H30N2O4 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 2-[[3-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]propylamino]methyl]benzoic acid |
| SMILES | Cc1oc(-c2ccccc2)nc1CCOc1ccc(CCCNCc2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C29H30N2O4/c1-21-27(31-28(35-21)23-9-3-2-4-10-23)17-19-34-25-15-13-22(14-16-25)8-7-18-30-20-24-11-5-6-12-26(24)29(32)33/h2-6,9-16,30H,7-8,17-20H2,1H3,(H,32,33) |
| InChIKey | VCIASPGKHXESOL-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|