C28H25N3O5 — CID 91099870
4-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]-2-nitroso-3-oxo-N-phenylbutanamide (PubChem CID 91099870) has the molecular formula C28H25N3O5 and a molecular weight of 483.52 g/mol. Its IUPAC name is 4-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]-2-nitroso-3-oxo-N-phenylbutanamide.
| Compound Name | 4-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]-2-nitroso-3-oxo-N-phenylbutanamide |
|---|---|
| PubChem CID | 91099870 |
| Molecular Formula | C28H25N3O5 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | 4-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]-2-nitroso-3-oxo-N-phenylbutanamide |
| SMILES | Cc1oc(-c2ccccc2)nc1CCOc1ccc(CC(=O)C(N=O)C(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C28H25N3O5/c1-19-24(30-28(36-19)21-8-4-2-5-9-21)16-17-35-23-14-12-20(13-15-23)18-25(32)26(31-34)27(33)29-22-10-6-3-7-11-22/h2-15,26H,16-18H2,1H3,(H,29,33) |
| InChIKey | RPMPGYZWUFCJKT-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|