C26H24N2O4 — CID 22712164
2-[[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]anilino]methyl]benzoic acid (PubChem CID 22712164) has the molecular formula C26H24N2O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is 2-[[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]anilino]methyl]benzoic acid.
| Compound Name | 2-[[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]anilino]methyl]benzoic acid |
|---|---|
| PubChem CID | 22712164 |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 2-[[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]anilino]methyl]benzoic acid |
| SMILES | Cc1oc(-c2ccccc2)nc1CCOc1ccc(NCc2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C26H24N2O4/c1-18-24(28-25(32-18)19-7-3-2-4-8-19)15-16-31-22-13-11-21(12-14-22)27-17-20-9-5-6-10-23(20)26(29)30/h2-14,27H,15-17H2,1H3,(H,29,30) |
| InChIKey | SRTDARYVIGHLFQ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|