C23H22N2O5 — CID 11729194
5-[[4-[3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propoxy]phenyl]methyl]-1,3-oxazolidine-2,4-dione (PubChem CID 11729194) has the molecular formula C23H22N2O5 and a molecular weight of 406.44 g/mol. Its IUPAC name is 5-[[4-[3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propoxy]phenyl]methyl]-1,3-oxazolidine-2,4-dione.
| Compound Name | 5-[[4-[3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propoxy]phenyl]methyl]-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 11729194 |
| Molecular Formula | C23H22N2O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 5-[[4-[3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propoxy]phenyl]methyl]-1,3-oxazolidine-2,4-dione |
| SMILES | Cc1oc(-c2ccccc2)nc1CCCOc1ccc(CC2OC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C23H22N2O5/c1-15-19(24-22(29-15)17-6-3-2-4-7-17)8-5-13-28-18-11-9-16(10-12-18)14-20-21(26)25-23(27)30-20/h2-4,6-7,9-12,20H,5,8,13-14H2,1H3,(H,25,26,27) |
| InChIKey | QRRABPHNKGWEMO-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|