C23H22N2O5S — CID 166949445
4-[2-(5-amino-2-phenyl-1,3-benzoxazol-6-yl)propan-2-yloxymethyl]benzenesulfonic acid (PubChem CID 166949445) has the molecular formula C23H22N2O5S and a molecular weight of 438.51 g/mol. Its IUPAC name is 4-[2-(5-amino-2-phenyl-1,3-benzoxazol-6-yl)propan-2-yloxymethyl]benzenesulfonic acid.
| Compound Name | 4-[2-(5-amino-2-phenyl-1,3-benzoxazol-6-yl)propan-2-yloxymethyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 166949445 |
| Molecular Formula | C23H22N2O5S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 4-[2-(5-amino-2-phenyl-1,3-benzoxazol-6-yl)propan-2-yloxymethyl]benzenesulfonic acid |
| SMILES | CC(C)(OCc1ccc(S(=O)(=O)O)cc1)c1cc2oc(-c3ccccc3)nc2cc1N |
| InChI | InChI=1S/C23H22N2O5S/c1-23(2,29-14-15-8-10-17(11-9-15)31(26,27)28)18-12-21-20(13-19(18)24)25-22(30-21)16-6-4-3-5-7-16/h3-13H,14,24H2,1-2H3,(H,26,27,28) |
| InChIKey | DHVCPKHHYVOZTK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|