C14H12BeN2O2 — CID 174487083
beryllium;hydride;2-(5-phenyl-1,3,4-oxadiazol-2-yl)phenol (PubChem CID 174487083) has the molecular formula C14H12BeN2O2 and a molecular weight of 249.27 g/mol. Its IUPAC name is beryllium;hydride;2-(5-phenyl-1,3,4-oxadiazol-2-yl)phenol.
| Compound Name | beryllium;hydride;2-(5-phenyl-1,3,4-oxadiazol-2-yl)phenol |
|---|---|
| PubChem CID | 174487083 |
| Molecular Formula | C14H12BeN2O2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | beryllium;hydride;2-(5-phenyl-1,3,4-oxadiazol-2-yl)phenol |
| SMILES | Oc1ccccc1-c1nnc(-c2ccccc2)o1.[Be+2].[H-].[H-] |
| InChI | InChI=1S/C14H10N2O2.Be.2H/c17-12-9-5-4-8-11(12)14-16-15-13(18-14)10-6-2-1-3-7-10;;;/h1-9,17H;;;/q;+2;2*-1 |
| InChIKey | TZYOQKXWMCMWCC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |