C14H16BrN3O3 — CID 66303625
5-bromo-6-methyl-2-(3,4,5-trimethoxyphenyl)pyrimidin-4-amine (PubChem CID 66303625) has the molecular formula C14H16BrN3O3 and a molecular weight of 354.20 g/mol. Its IUPAC name is 5-bromo-6-methyl-2-(3,4,5-trimethoxyphenyl)pyrimidin-4-amine.
| Compound Name | 5-bromo-6-methyl-2-(3,4,5-trimethoxyphenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 66303625 |
| Molecular Formula | C14H16BrN3O3 |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | 5-bromo-6-methyl-2-(3,4,5-trimethoxyphenyl)pyrimidin-4-amine |
| SMILES | COc1cc(-c2nc(C)c(Br)c(N)n2)cc(OC)c1OC |
| InChI | InChI=1S/C14H16BrN3O3/c1-7-11(15)13(16)18-14(17-7)8-5-9(19-2)12(21-4)10(6-8)20-3/h5-6H,1-4H3,(H2,16,17,18) |
| InChIKey | OYYFRTKEACOCSO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 79.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |