C14H14BrNO3 — CID 141375557
3-bromo-5-(3,4,5-trimethoxyphenyl)pyridine (PubChem CID 141375557) has the molecular formula C14H14BrNO3 and a molecular weight of 324.17 g/mol. Its IUPAC name is 3-bromo-5-(3,4,5-trimethoxyphenyl)pyridine.
| Compound Name | 3-bromo-5-(3,4,5-trimethoxyphenyl)pyridine |
|---|---|
| PubChem CID | 141375557 |
| Molecular Formula | C14H14BrNO3 |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 3-bromo-5-(3,4,5-trimethoxyphenyl)pyridine |
| SMILES | COc1cc(-c2cncc(Br)c2)cc(OC)c1OC |
| InChI | InChI=1S/C14H14BrNO3/c1-17-12-5-9(6-13(18-2)14(12)19-3)10-4-11(15)8-16-7-10/h4-8H,1-3H3 |
| InChIKey | WLQJNYXSUALDKA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |