C17H19NO5 — CID 22557861
ethyl 5-(3,4,5-trimethoxyphenyl)pyridine-3-carboxylate (PubChem CID 22557861) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is ethyl 5-(3,4,5-trimethoxyphenyl)pyridine-3-carboxylate.
| Compound Name | ethyl 5-(3,4,5-trimethoxyphenyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 22557861 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | ethyl 5-(3,4,5-trimethoxyphenyl)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cncc(-c2cc(OC)c(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C17H19NO5/c1-5-23-17(19)13-6-12(9-18-10-13)11-7-14(20-2)16(22-4)15(8-11)21-3/h6-10H,5H2,1-4H3 |
| InChIKey | BRQKCIDXEIXJKI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |