C18H20O6 — CID 51042654
ethyl 2-hydroxy-4-(3,4,5-trimethoxyphenyl)benzoate (PubChem CID 51042654) has the molecular formula C18H20O6 and a molecular weight of 332.35 g/mol. Its IUPAC name is ethyl 2-hydroxy-4-(3,4,5-trimethoxyphenyl)benzoate.
| Compound Name | ethyl 2-hydroxy-4-(3,4,5-trimethoxyphenyl)benzoate |
|---|---|
| PubChem CID | 51042654 |
| Molecular Formula | C18H20O6 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | ethyl 2-hydroxy-4-(3,4,5-trimethoxyphenyl)benzoate |
| SMILES | CCOC(=O)c1ccc(-c2cc(OC)c(OC)c(OC)c2)cc1O |
| InChI | InChI=1S/C18H20O6/c1-5-24-18(20)13-7-6-11(8-14(13)19)12-9-15(21-2)17(23-4)16(10-12)22-3/h6-10,19H,5H2,1-4H3 |
| InChIKey | QALPHRWQJMJFLN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |