C14H17N3O5 — CID 154379837
6-amino-5-[(3,4,5-trimethoxyphenyl)methyl]-1H-pyrimidine-2,4-dione (PubChem CID 154379837) has the molecular formula C14H17N3O5 and a molecular weight of 307.31 g/mol. Its IUPAC name is 6-amino-5-[(3,4,5-trimethoxyphenyl)methyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-amino-5-[(3,4,5-trimethoxyphenyl)methyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 154379837 |
| Molecular Formula | C14H17N3O5 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 6-amino-5-[(3,4,5-trimethoxyphenyl)methyl]-1H-pyrimidine-2,4-dione |
| SMILES | COc1cc(Cc2c(N)[nH]c(=O)[nH]c2=O)cc(OC)c1OC |
| InChI | InChI=1S/C14H17N3O5/c1-20-9-5-7(6-10(21-2)11(9)22-3)4-8-12(15)16-14(19)17-13(8)18/h5-6H,4H2,1-3H3,(H4,15,16,17,18,19) |
| InChIKey | DLYNGZIXSWXCQT-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 119.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |