C30H38O10 — CID 15638734
1,2,3-trimethoxy-5-[(3,4,5-trimethoxyphenyl)methoxymethyl]-4-[(3,4,5-trimethoxyphenyl)methyl]benzene (PubChem CID 15638734) has the molecular formula C30H38O10 and a molecular weight of 558.62 g/mol. Its IUPAC name is 1,2,3-trimethoxy-5-[(3,4,5-trimethoxyphenyl)methoxymethyl]-4-[(3,4,5-trimethoxyphenyl)methyl]benzene.
| Compound Name | 1,2,3-trimethoxy-5-[(3,4,5-trimethoxyphenyl)methoxymethyl]-4-[(3,4,5-trimethoxyphenyl)methyl]benzene |
|---|---|
| PubChem CID | 15638734 |
| Molecular Formula | C30H38O10 |
| Molecular Weight | 558.62 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | 1,2,3-trimethoxy-5-[(3,4,5-trimethoxyphenyl)methoxymethyl]-4-[(3,4,5-trimethoxyphenyl)methyl]benzene |
| SMILES | COc1cc(COCc2cc(OC)c(OC)c(OC)c2Cc2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C30H38O10/c1-31-22-11-18(12-23(32-2)28(22)37-7)10-21-20(15-26(35-5)30(39-9)27(21)36-6)17-40-16-19-13-24(33-3)29(38-8)25(14-19)34-4/h11-15H,10,16-17H2,1-9H3 |
| InChIKey | NVGOWIWYVJQIOE-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.62 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |