C12H15N3O4 — CID 44660539
azanium 5-[(2-methoxyphenyl)methyl]-2,4-dioxo-1H-pyrimidin-6-olate (PubChem CID 44660539) has the molecular formula C12H15N3O4 and a molecular weight of 265.27 g/mol. Its IUPAC name is azanium 5-[(2-methoxyphenyl)methyl]-2,4-dioxo-1H-pyrimidin-6-olate.
| Compound Name | azanium 5-[(2-methoxyphenyl)methyl]-2,4-dioxo-1H-pyrimidin-6-olate |
|---|---|
| PubChem CID | 44660539 |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | azanium 5-[(2-methoxyphenyl)methyl]-2,4-dioxo-1H-pyrimidin-6-olate |
| SMILES | COc1ccccc1Cc1c([O-])[nH]c(=O)[nH]c1=O.[NH4+] |
| InChI | InChI=1S/C12H12N2O4.H3N/c1-18-9-5-3-2-4-7(9)6-8-10(15)13-12(17)14-11(8)16;/h2-5H,6H2,1H3,(H3,13,14,15,16,17);1H3 |
| InChIKey | PLKSZIWYLYZJIE-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 134.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |