C12H13N3O4 — CID 82554305
6-[(2,3-dimethoxyphenyl)methyl]-2H-1,2,4-triazine-3,5-dione (PubChem CID 82554305) has the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. Its IUPAC name is 6-[(2,3-dimethoxyphenyl)methyl]-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-[(2,3-dimethoxyphenyl)methyl]-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 82554305 |
| Molecular Formula | C12H13N3O4 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 6-[(2,3-dimethoxyphenyl)methyl]-2H-1,2,4-triazine-3,5-dione |
| SMILES | COc1cccc(Cc2n[nH]c(=O)[nH]c2=O)c1OC |
| InChI | InChI=1S/C12H13N3O4/c1-18-9-5-3-4-7(10(9)19-2)6-8-11(16)13-12(17)15-14-8/h3-5H,6H2,1-2H3,(H2,13,15,16,17) |
| InChIKey | RWEPABCGDZEWOE-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |