C17H22N2O3 — CID 83954623
6-methyl-5-[(2-pentoxyphenyl)methyl]-1H-pyrimidine-2,4-dione (PubChem CID 83954623) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is 6-methyl-5-[(2-pentoxyphenyl)methyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-methyl-5-[(2-pentoxyphenyl)methyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 83954623 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 6-methyl-5-[(2-pentoxyphenyl)methyl]-1H-pyrimidine-2,4-dione |
| SMILES | CCCCCOc1ccccc1Cc1c(C)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H22N2O3/c1-3-4-7-10-22-15-9-6-5-8-13(15)11-14-12(2)18-17(21)19-16(14)20/h5-6,8-9H,3-4,7,10-11H2,1-2H3,(H2,18,19,20,21) |
| InChIKey | DFEBTFGFESKWEL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|