C13H15N3O4 — CID 14674009
(5-amino-1H-pyrazol-4-yl)-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 14674009) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is (5-amino-1H-pyrazol-4-yl)-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | (5-amino-1H-pyrazol-4-yl)-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 14674009 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | (5-amino-1H-pyrazol-4-yl)-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)c2cn[nH]c2N)cc(OC)c1OC |
| InChI | InChI=1S/C13H15N3O4/c1-18-9-4-7(5-10(19-2)12(9)20-3)11(17)8-6-15-16-13(8)14/h4-6H,1-3H3,(H3,14,15,16) |
| InChIKey | AUXVXVDFOJUAJH-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |