C12H13ClN4O2 — CID 43337149
5-amino-N-(4-chloro-2-methoxy-5-methylphenyl)-1H-pyrazole-4-carboxamide (PubChem CID 43337149) has the molecular formula C12H13ClN4O2 and a molecular weight of 280.72 g/mol. Its IUPAC name is 5-amino-N-(4-chloro-2-methoxy-5-methylphenyl)-1H-pyrazole-4-carboxamide.
| Compound Name | 5-amino-N-(4-chloro-2-methoxy-5-methylphenyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 43337149 |
| Molecular Formula | C12H13ClN4O2 |
| Molecular Weight | 280.72 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 5-amino-N-(4-chloro-2-methoxy-5-methylphenyl)-1H-pyrazole-4-carboxamide |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)c1cn[nH]c1N |
| InChI | InChI=1S/C12H13ClN4O2/c1-6-3-9(10(19-2)4-8(6)13)16-12(18)7-5-15-17-11(7)14/h3-5H,1-2H3,(H,16,18)(H3,14,15,17) |
| InChIKey | MOIQOVNHHHZPNB-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.72 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |