C15H11Cl2F2NO2 — CID 4852133
2-chloro-N-(4-chloro-2-methoxy-5-methylphenyl)-4,5-difluorobenzamide (PubChem CID 4852133) has the molecular formula C15H11Cl2F2NO2 and a molecular weight of 346.16 g/mol. Its IUPAC name is 2-chloro-N-(4-chloro-2-methoxy-5-methylphenyl)-4,5-difluorobenzamide.
| Compound Name | 2-chloro-N-(4-chloro-2-methoxy-5-methylphenyl)-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 4852133 |
| Molecular Formula | C15H11Cl2F2NO2 |
| Molecular Weight | 346.16 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | 2-chloro-N-(4-chloro-2-methoxy-5-methylphenyl)-4,5-difluorobenzamide |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C15H11Cl2F2NO2/c1-7-3-13(14(22-2)6-9(7)16)20-15(21)8-4-11(18)12(19)5-10(8)17/h3-6H,1-2H3,(H,20,21) |
| InChIKey | XCTVCTKTBQDDMZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.16 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|