C15H12BrClFNO2 — CID 60589124
4-bromo-N-(4-chloro-2-methoxy-5-methylphenyl)-3-fluorobenzamide (PubChem CID 60589124) has the molecular formula C15H12BrClFNO2 and a molecular weight of 372.62 g/mol. Its IUPAC name is 4-bromo-N-(4-chloro-2-methoxy-5-methylphenyl)-3-fluorobenzamide.
| Compound Name | 4-bromo-N-(4-chloro-2-methoxy-5-methylphenyl)-3-fluorobenzamide |
|---|---|
| PubChem CID | 60589124 |
| Molecular Formula | C15H12BrClFNO2 |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 370.97 |
| IUPAC Name | 4-bromo-N-(4-chloro-2-methoxy-5-methylphenyl)-3-fluorobenzamide |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)c1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C15H12BrClFNO2/c1-8-5-13(14(21-2)7-11(8)17)19-15(20)9-3-4-10(16)12(18)6-9/h3-7H,1-2H3,(H,19,20) |
| InChIKey | GGYXOEBEBALNGY-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |