C16H14Cl2FNO3 — CID 27669456
2,4-dichloro-N-(4,5-dimethoxy-2-methylphenyl)-5-fluorobenzamide (PubChem CID 27669456) has the molecular formula C16H14Cl2FNO3 and a molecular weight of 358.20 g/mol. Its IUPAC name is 2,4-dichloro-N-(4,5-dimethoxy-2-methylphenyl)-5-fluorobenzamide.
| Compound Name | 2,4-dichloro-N-(4,5-dimethoxy-2-methylphenyl)-5-fluorobenzamide |
|---|---|
| PubChem CID | 27669456 |
| Molecular Formula | C16H14Cl2FNO3 |
| Molecular Weight | 358.20 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | 2,4-dichloro-N-(4,5-dimethoxy-2-methylphenyl)-5-fluorobenzamide |
| SMILES | COc1cc(C)c(NC(=O)c2cc(F)c(Cl)cc2Cl)cc1OC |
| InChI | InChI=1S/C16H14Cl2FNO3/c1-8-4-14(22-2)15(23-3)7-13(8)20-16(21)9-5-12(19)11(18)6-10(9)17/h4-7H,1-3H3,(H,20,21) |
| InChIKey | HQKHXHQMPZONHS-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.20 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|