C15H15FN2O3 — CID 115496998
N-(4,5-dimethoxy-2-methylphenyl)-6-fluoropyridine-2-carboxamide (PubChem CID 115496998) has the molecular formula C15H15FN2O3 and a molecular weight of 290.29 g/mol. Its IUPAC name is N-(4,5-dimethoxy-2-methylphenyl)-6-fluoropyridine-2-carboxamide.
| Compound Name | N-(4,5-dimethoxy-2-methylphenyl)-6-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 115496998 |
| Molecular Formula | C15H15FN2O3 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | N-(4,5-dimethoxy-2-methylphenyl)-6-fluoropyridine-2-carboxamide |
| SMILES | COc1cc(C)c(NC(=O)c2cccc(F)n2)cc1OC |
| InChI | InChI=1S/C15H15FN2O3/c1-9-7-12(20-2)13(21-3)8-11(9)18-15(19)10-5-4-6-14(16)17-10/h4-8H,1-3H3,(H,18,19) |
| InChIKey | YSAQPHQXTRZDNE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|