C19H18Cl2NO5S- — CID 53426222
4-[(3,4-dichlorophenyl)methyl]-6,7-dimethoxyisoquinoline;methanesulfonate (PubChem CID 53426222) has the molecular formula C19H18Cl2NO5S- and a molecular weight of 443.33 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)methyl]-6,7-dimethoxyisoquinoline;methanesulfonate.
| Compound Name | 4-[(3,4-dichlorophenyl)methyl]-6,7-dimethoxyisoquinoline;methanesulfonate |
|---|---|
| PubChem CID | 53426222 |
| Molecular Formula | C19H18Cl2NO5S- |
| Molecular Weight | 443.33 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)methyl]-6,7-dimethoxyisoquinoline;methanesulfonate |
| SMILES | COc1cc2cncc(Cc3ccc(Cl)c(Cl)c3)c2cc1OC.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C18H15Cl2NO2.CH4O3S/c1-22-17-7-13-10-21-9-12(14(13)8-18(17)23-2)5-11-3-4-15(19)16(20)6-11;1-5(2,3)4/h3-4,6-10H,5H2,1-2H3;1H3,(H,2,3,4)/p-1 |
| InChIKey | XKBZAQHBLDGTCE-UHFFFAOYSA-M |
| XLogP | 4.31 |
| TPSA | 88.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.33 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|