C24H26N2O3 — CID 158617122
4-[(8-ethoxyquinolin-2-yl)methyl]-6,7-dimethoxyisoquinoline;methane (PubChem CID 158617122) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is 4-[(8-ethoxyquinolin-2-yl)methyl]-6,7-dimethoxyisoquinoline;methane.
| Compound Name | 4-[(8-ethoxyquinolin-2-yl)methyl]-6,7-dimethoxyisoquinoline;methane |
|---|---|
| PubChem CID | 158617122 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 4-[(8-ethoxyquinolin-2-yl)methyl]-6,7-dimethoxyisoquinoline;methane |
| SMILES | C.CCOc1cccc2ccc(Cc3cncc4cc(OC)c(OC)cc34)nc12 |
| InChI | InChI=1S/C23H22N2O3.CH4/c1-4-28-20-7-5-6-15-8-9-18(25-23(15)20)10-16-13-24-14-17-11-21(26-2)22(27-3)12-19(16)17;/h5-9,11-14H,4,10H2,1-3H3;1H4 |
| InChIKey | HXNJQFWGOSFHNJ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |