C26H29N3O5 — CID 144620309
2-[2-[[6,7-dimethoxy-1-(methoxymethyl)isoquinolin-4-yl]methyl]quinolin-8-yl]oxyacetaldehyde;methanamine (PubChem CID 144620309) has the molecular formula C26H29N3O5 and a molecular weight of 463.53 g/mol. Its IUPAC name is 2-[2-[[6,7-dimethoxy-1-(methoxymethyl)isoquinolin-4-yl]methyl]quinolin-8-yl]oxyacetaldehyde;methanamine.
| Compound Name | 2-[2-[[6,7-dimethoxy-1-(methoxymethyl)isoquinolin-4-yl]methyl]quinolin-8-yl]oxyacetaldehyde;methanamine |
|---|---|
| PubChem CID | 144620309 |
| Molecular Formula | C26H29N3O5 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 2-[2-[[6,7-dimethoxy-1-(methoxymethyl)isoquinolin-4-yl]methyl]quinolin-8-yl]oxyacetaldehyde;methanamine |
| SMILES | CN.COCc1ncc(Cc2ccc3cccc(OCC=O)c3n2)c2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C25H24N2O5.CH5N/c1-29-15-21-20-13-24(31-3)23(30-2)12-19(20)17(14-26-21)11-18-8-7-16-5-4-6-22(25(16)27-18)32-10-9-28;1-2/h4-9,12-14H,10-11,15H2,1-3H3;2H2,1H3 |
| InChIKey | YQRLZIZMYWXVOW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 105.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|