C22H21N3O5S — CID 118543746
[2-[(6,7-dimethoxy-1-methylisoquinolin-4-yl)methyl]quinolin-8-yl] sulfamate (PubChem CID 118543746) has the molecular formula C22H21N3O5S and a molecular weight of 439.49 g/mol. Its IUPAC name is [2-[(6,7-dimethoxy-1-methylisoquinolin-4-yl)methyl]quinolin-8-yl] sulfamate.
| Compound Name | [2-[(6,7-dimethoxy-1-methylisoquinolin-4-yl)methyl]quinolin-8-yl] sulfamate |
|---|---|
| PubChem CID | 118543746 |
| Molecular Formula | C22H21N3O5S |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | [2-[(6,7-dimethoxy-1-methylisoquinolin-4-yl)methyl]quinolin-8-yl] sulfamate |
| SMILES | COc1cc2c(Cc3ccc4cccc(OS(N)(=O)=O)c4n3)cnc(C)c2cc1OC |
| InChI | InChI=1S/C22H21N3O5S/c1-13-17-10-20(28-2)21(29-3)11-18(17)15(12-24-13)9-16-8-7-14-5-4-6-19(22(14)25-16)30-31(23,26)27/h4-8,10-12H,9H2,1-3H3,(H2,23,26,27) |
| InChIKey | IDKOCMYZPAERLO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 113.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |