C28H31N3O4 — CID 90131174
N-[2-[2-[(6,7-dimethoxy-1-propylisoquinolin-4-yl)methyl]quinolin-8-yl]oxyethyl]acetamide (PubChem CID 90131174) has the molecular formula C28H31N3O4 and a molecular weight of 473.57 g/mol. Its IUPAC name is N-[2-[2-[(6,7-dimethoxy-1-propylisoquinolin-4-yl)methyl]quinolin-8-yl]oxyethyl]acetamide.
| Compound Name | N-[2-[2-[(6,7-dimethoxy-1-propylisoquinolin-4-yl)methyl]quinolin-8-yl]oxyethyl]acetamide |
|---|---|
| PubChem CID | 90131174 |
| Molecular Formula | C28H31N3O4 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | N-[2-[2-[(6,7-dimethoxy-1-propylisoquinolin-4-yl)methyl]quinolin-8-yl]oxyethyl]acetamide |
| SMILES | CCCc1ncc(Cc2ccc3cccc(OCCNC(C)=O)c3n2)c2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C28H31N3O4/c1-5-7-24-23-16-27(34-4)26(33-3)15-22(23)20(17-30-24)14-21-11-10-19-8-6-9-25(28(19)31-21)35-13-12-29-18(2)32/h6,8-11,15-17H,5,7,12-14H2,1-4H3,(H,29,32) |
| InChIKey | ZZWUAXDJSLWGSA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|