C19H19ClINO2 — CID 10344010
4-[(4-chlorophenyl)methyl]-6,7-dimethoxy-2-methylisoquinolin-2-ium iodide (PubChem CID 10344010) has the molecular formula C19H19ClINO2 and a molecular weight of 455.72 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methyl]-6,7-dimethoxy-2-methylisoquinolin-2-ium iodide.
| Compound Name | 4-[(4-chlorophenyl)methyl]-6,7-dimethoxy-2-methylisoquinolin-2-ium iodide |
|---|---|
| PubChem CID | 10344010 |
| Molecular Formula | C19H19ClINO2 |
| Molecular Weight | 455.72 g/mol |
| Exact Mass | 455.01 |
| IUPAC Name | 4-[(4-chlorophenyl)methyl]-6,7-dimethoxy-2-methylisoquinolin-2-ium iodide |
| SMILES | COc1cc2c[n+](C)cc(Cc3ccc(Cl)cc3)c2cc1OC.[I-] |
| InChI | InChI=1S/C19H19ClNO2.HI/c1-21-11-14(8-13-4-6-16(20)7-5-13)17-10-19(23-3)18(22-2)9-15(17)12-21;/h4-7,9-12H,8H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | NLOITAICDMLTFB-UHFFFAOYSA-M |
| XLogP | 0.93 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.72 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|