C19H22ClNO4 — CID 31948362
3-(4-chlorophenyl)-N-[(2,4,5-trimethoxyphenyl)methyl]propanamide (PubChem CID 31948362) has the molecular formula C19H22ClNO4 and a molecular weight of 363.84 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-[(2,4,5-trimethoxyphenyl)methyl]propanamide.
| Compound Name | 3-(4-chlorophenyl)-N-[(2,4,5-trimethoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 31948362 |
| Molecular Formula | C19H22ClNO4 |
| Molecular Weight | 363.84 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 3-(4-chlorophenyl)-N-[(2,4,5-trimethoxyphenyl)methyl]propanamide |
| SMILES | COc1cc(OC)c(OC)cc1CNC(=O)CCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H22ClNO4/c1-23-16-11-18(25-3)17(24-2)10-14(16)12-21-19(22)9-6-13-4-7-15(20)8-5-13/h4-5,7-8,10-11H,6,9,12H2,1-3H3,(H,21,22) |
| InChIKey | JWJXQYGLXQRTOM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.84 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |