C21H22ClNO6 — CID 9018666
[2-oxo-2-[(2,4,5-trimethoxyphenyl)methylamino]ethyl] (E)-3-(4-chlorophenyl)prop-2-enoate (PubChem CID 9018666) has the molecular formula C21H22ClNO6 and a molecular weight of 419.86 g/mol. Its IUPAC name is [2-oxo-2-[(2,4,5-trimethoxyphenyl)methylamino]ethyl] (E)-3-(4-chlorophenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-[(2,4,5-trimethoxyphenyl)methylamino]ethyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 9018666 |
| Molecular Formula | C21H22ClNO6 |
| Molecular Weight | 419.86 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | [2-oxo-2-[(2,4,5-trimethoxyphenyl)methylamino]ethyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
| SMILES | COc1cc(OC)c(OC)cc1CNC(=O)COC(=O)/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H22ClNO6/c1-26-17-11-19(28-3)18(27-2)10-15(17)12-23-20(24)13-29-21(25)9-6-14-4-7-16(22)8-5-14/h4-11H,12-13H2,1-3H3,(H,23,24)/b9-6+ |
| InChIKey | LDKLYROEBAVWFW-RMKNXTFCSA-N |
| XLogP | 3.24 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.86 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|