C21H21ClO5 — CID 155512360
[(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enyl] (E)-3-(4-chlorophenyl)prop-2-enoate (PubChem CID 155512360) has the molecular formula C21H21ClO5 and a molecular weight of 388.85 g/mol. Its IUPAC name is [(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enyl] (E)-3-(4-chlorophenyl)prop-2-enoate.
| Compound Name | [(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 155512360 |
| Molecular Formula | C21H21ClO5 |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | [(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
| SMILES | COc1cc(OC)c(OC)cc1/C=C/COC(=O)/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H21ClO5/c1-24-18-14-20(26-3)19(25-2)13-16(18)5-4-12-27-21(23)11-8-15-6-9-17(22)10-7-15/h4-11,13-14H,12H2,1-3H3/b5-4+,11-8+ |
| InChIKey | JFQWFJKNUWMMBF-OCJIRGAFSA-N |
| XLogP | 4.64 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|