C15H20O5 — CID 130417623
[(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enyl] propanoate (PubChem CID 130417623) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is [(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enyl] propanoate.
| Compound Name | [(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enyl] propanoate |
|---|---|
| PubChem CID | 130417623 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | [(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enyl] propanoate |
| SMILES | CCC(=O)OC/C=C/c1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C15H20O5/c1-5-15(16)20-8-6-7-11-9-13(18-3)14(19-4)10-12(11)17-2/h6-7,9-10H,5,8H2,1-4H3/b7-6+ |
| InChIKey | IIICEJAMHXWUTE-VOTSOKGWSA-N |
| XLogP | 2.68 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |