C24H36O5 — CID 86574393
[(E)-3-(4-heptanoyloxy-3-methoxyphenyl)prop-2-enyl] heptanoate (PubChem CID 86574393) has the molecular formula C24H36O5 and a molecular weight of 404.55 g/mol. Its IUPAC name is [(E)-3-(4-heptanoyloxy-3-methoxyphenyl)prop-2-enyl] heptanoate.
| Compound Name | [(E)-3-(4-heptanoyloxy-3-methoxyphenyl)prop-2-enyl] heptanoate |
|---|---|
| PubChem CID | 86574393 |
| Molecular Formula | C24H36O5 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | [(E)-3-(4-heptanoyloxy-3-methoxyphenyl)prop-2-enyl] heptanoate |
| SMILES | CCCCCCC(=O)OC/C=C/c1ccc(OC(=O)CCCCCC)c(OC)c1 |
| InChI | InChI=1S/C24H36O5/c1-4-6-8-10-14-23(25)28-18-12-13-20-16-17-21(22(19-20)27-3)29-24(26)15-11-9-7-5-2/h12-13,16-17,19H,4-11,14-15,18H2,1-3H3/b13-12+ |
| InChIKey | UIFYBHSKZOBAHO-OUKQBFOZSA-N |
| XLogP | 6.10 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|