C18H20ClNO2 — CID 110297627
4-(4-chlorophenyl)-N-[(2-methoxyphenyl)methyl]butanamide (PubChem CID 110297627) has the molecular formula C18H20ClNO2 and a molecular weight of 317.82 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[(2-methoxyphenyl)methyl]butanamide.
| Compound Name | 4-(4-chlorophenyl)-N-[(2-methoxyphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 110297627 |
| Molecular Formula | C18H20ClNO2 |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[(2-methoxyphenyl)methyl]butanamide |
| SMILES | COc1ccccc1CNC(=O)CCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H20ClNO2/c1-22-17-7-3-2-6-15(17)13-20-18(21)8-4-5-14-9-11-16(19)12-10-14/h2-3,6-7,9-12H,4-5,8,13H2,1H3,(H,20,21) |
| InChIKey | WBDNIYQRYKWZJT-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |