C17H16N2O3 — CID 143309051
4-(6,7-dimethoxyisoquinolin-4-yl)oxyaniline (PubChem CID 143309051) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is 4-(6,7-dimethoxyisoquinolin-4-yl)oxyaniline.
| Compound Name | 4-(6,7-dimethoxyisoquinolin-4-yl)oxyaniline |
|---|---|
| PubChem CID | 143309051 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 4-(6,7-dimethoxyisoquinolin-4-yl)oxyaniline |
| SMILES | COc1cc2cncc(Oc3ccc(N)cc3)c2cc1OC |
| InChI | InChI=1S/C17H16N2O3/c1-20-15-7-11-9-19-10-17(14(11)8-16(15)21-2)22-13-5-3-12(18)4-6-13/h3-10H,18H2,1-2H3 |
| InChIKey | QZYAPDQYYADYET-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|