C24H19N5O3 — CID 90709666
3-[[5-(8,9-dimethoxybenzo[c][2,7]naphthyridin-2-yl)-3-pyridinyl]oxy]pyridin-4-amine (PubChem CID 90709666) has the molecular formula C24H19N5O3 and a molecular weight of 425.45 g/mol. Its IUPAC name is 3-[[5-(8,9-dimethoxybenzo[c][2,7]naphthyridin-2-yl)-3-pyridinyl]oxy]pyridin-4-amine.
| Compound Name | 3-[[5-(8,9-dimethoxybenzo[c][2,7]naphthyridin-2-yl)-3-pyridinyl]oxy]pyridin-4-amine |
|---|---|
| PubChem CID | 90709666 |
| Molecular Formula | C24H19N5O3 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 3-[[5-(8,9-dimethoxybenzo[c][2,7]naphthyridin-2-yl)-3-pyridinyl]oxy]pyridin-4-amine |
| SMILES | COc1cc2ncc3cnc(-c4cncc(Oc5cnccc5N)c4)cc3c2cc1OC |
| InChI | InChI=1S/C24H19N5O3/c1-30-22-7-18-17-6-20(28-10-15(17)11-29-21(18)8-23(22)31-2)14-5-16(12-27-9-14)32-24-13-26-4-3-19(24)25/h3-13H,1-2H3,(H2,25,26) |
| InChIKey | ZJKPSIZTXCSZME-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 105.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|