C22H23N5O3 — CID 69169898
2-[5-(2-aminopropoxy)-3-pyridinyl]-8,9-dimethoxybenzo[f][2,7]naphthyridin-4-amine (PubChem CID 69169898) has the molecular formula C22H23N5O3 and a molecular weight of 405.46 g/mol. Its IUPAC name is 2-[5-(2-aminopropoxy)-3-pyridinyl]-8,9-dimethoxybenzo[f][2,7]naphthyridin-4-amine.
| Compound Name | 2-[5-(2-aminopropoxy)-3-pyridinyl]-8,9-dimethoxybenzo[f][2,7]naphthyridin-4-amine |
|---|---|
| PubChem CID | 69169898 |
| Molecular Formula | C22H23N5O3 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 2-[5-(2-aminopropoxy)-3-pyridinyl]-8,9-dimethoxybenzo[f][2,7]naphthyridin-4-amine |
| SMILES | COc1cc2ncc3c(N)nc(-c4cncc(OCC(C)N)c4)cc3c2cc1OC |
| InChI | InChI=1S/C22H23N5O3/c1-12(23)11-30-14-4-13(8-25-9-14)18-5-15-16-6-20(28-2)21(29-3)7-19(16)26-10-17(15)22(24)27-18/h4-10,12H,11,23H2,1-3H3,(H2,24,27) |
| InChIKey | CFWZNCTWCNPULR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 118.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|