C27H25ClN6O4 — CID 69171077
2-[5-[(2R)-2-amino-3-[(4-chloro-2-pyridinyl)oxy]propoxy]-3-pyridinyl]-8,9-dimethoxybenzo[f][2,7]naphthyridin-4-amine (PubChem CID 69171077) has the molecular formula C27H25ClN6O4 and a molecular weight of 532.99 g/mol. Its IUPAC name is 2-[5-[(2R)-2-amino-3-[(4-chloro-2-pyridinyl)oxy]propoxy]-3-pyridinyl]-8,9-dimethoxybenzo[f][2,7]naphthyridin-4-amine.
| Compound Name | 2-[5-[(2R)-2-amino-3-[(4-chloro-2-pyridinyl)oxy]propoxy]-3-pyridinyl]-8,9-dimethoxybenzo[f][2,7]naphthyridin-4-amine |
|---|---|
| PubChem CID | 69171077 |
| Molecular Formula | C27H25ClN6O4 |
| Molecular Weight | 532.99 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | 2-[5-[(2R)-2-amino-3-[(4-chloro-2-pyridinyl)oxy]propoxy]-3-pyridinyl]-8,9-dimethoxybenzo[f][2,7]naphthyridin-4-amine |
| SMILES | COc1cc2ncc3c(N)nc(-c4cncc(OC[C@@H](N)COc5cc(Cl)ccn5)c4)cc3c2cc1OC |
| InChI | InChI=1S/C27H25ClN6O4/c1-35-24-8-20-19-7-22(34-27(30)21(19)12-33-23(20)9-25(24)36-2)15-5-18(11-31-10-15)37-13-17(29)14-38-26-6-16(28)3-4-32-26/h3-12,17H,13-14,29H2,1-2H3,(H2,30,34)/t17-/m1/s1 |
| InChIKey | BYEIVDWDBARBMT-QGZVFWFLSA-N |
| XLogP | 4.28 |
| TPSA | 140.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.99 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|