C22H23N5O2 — CID 69170002
2-[5-[(2S)-2-aminobutoxy]-3-pyridinyl]-8-methoxybenzo[f][2,7]naphthyridin-4-amine (PubChem CID 69170002) has the molecular formula C22H23N5O2 and a molecular weight of 389.46 g/mol. Its IUPAC name is 2-[5-[(2S)-2-aminobutoxy]-3-pyridinyl]-8-methoxybenzo[f][2,7]naphthyridin-4-amine.
| Compound Name | 2-[5-[(2S)-2-aminobutoxy]-3-pyridinyl]-8-methoxybenzo[f][2,7]naphthyridin-4-amine |
|---|---|
| PubChem CID | 69170002 |
| Molecular Formula | C22H23N5O2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 2-[5-[(2S)-2-aminobutoxy]-3-pyridinyl]-8-methoxybenzo[f][2,7]naphthyridin-4-amine |
| SMILES | CC[C@H](N)COc1cncc(-c2cc3c(cnc4cc(OC)ccc43)c(N)n2)c1 |
| InChI | InChI=1S/C22H23N5O2/c1-3-14(23)12-29-16-6-13(9-25-10-16)20-8-18-17-5-4-15(28-2)7-21(17)26-11-19(18)22(24)27-20/h4-11,14H,3,12,23H2,1-2H3,(H2,24,27)/t14-/m0/s1 |
| InChIKey | WUFVBJNSMGEUPN-AWEZNQCLSA-N |
| XLogP | 3.55 |
| TPSA | 109.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|