C25H29N5O4 — CID 69171285
2-[5-[(2S)-2-aminobutoxy]-3-pyridinyl]-9-methoxy-8-(2-methoxyethoxy)benzo[f][2,7]naphthyridin-4-amine (PubChem CID 69171285) has the molecular formula C25H29N5O4 and a molecular weight of 463.54 g/mol. Its IUPAC name is 2-[5-[(2S)-2-aminobutoxy]-3-pyridinyl]-9-methoxy-8-(2-methoxyethoxy)benzo[f][2,7]naphthyridin-4-amine.
| Compound Name | 2-[5-[(2S)-2-aminobutoxy]-3-pyridinyl]-9-methoxy-8-(2-methoxyethoxy)benzo[f][2,7]naphthyridin-4-amine |
|---|---|
| PubChem CID | 69171285 |
| Molecular Formula | C25H29N5O4 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | 2-[5-[(2S)-2-aminobutoxy]-3-pyridinyl]-9-methoxy-8-(2-methoxyethoxy)benzo[f][2,7]naphthyridin-4-amine |
| SMILES | CC[C@H](N)COc1cncc(-c2cc3c(cnc4cc(OCCOC)c(OC)cc43)c(N)n2)c1 |
| InChI | InChI=1S/C25H29N5O4/c1-4-16(26)14-34-17-7-15(11-28-12-17)21-8-18-19-9-23(32-3)24(33-6-5-31-2)10-22(19)29-13-20(18)25(27)30-21/h7-13,16H,4-6,14,26H2,1-3H3,(H2,27,30)/t16-/m0/s1 |
| InChIKey | NGZRZRVFUBJJSK-INIZCTEOSA-N |
| XLogP | 3.58 |
| TPSA | 127.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|