C28H33N5O5 — CID 91362706
tert-butyl N-[(2S)-1-[[5-(4-amino-8,9-dimethoxybenzo[c][2,7]naphthyridin-2-yl)-3-pyridinyl]oxy]butan-2-yl]carbamate (PubChem CID 91362706) has the molecular formula C28H33N5O5 and a molecular weight of 519.60 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[5-(4-amino-8,9-dimethoxybenzo[c][2,7]naphthyridin-2-yl)-3-pyridinyl]oxy]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[5-(4-amino-8,9-dimethoxybenzo[c][2,7]naphthyridin-2-yl)-3-pyridinyl]oxy]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 91362706 |
| Molecular Formula | C28H33N5O5 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.25 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[5-(4-amino-8,9-dimethoxybenzo[c][2,7]naphthyridin-2-yl)-3-pyridinyl]oxy]butan-2-yl]carbamate |
| SMILES | CC[C@@H](COc1cncc(-c2cc3c(cnc4cc(OC)c(OC)cc43)c(N)n2)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H33N5O5/c1-7-17(32-27(34)38-28(2,3)4)15-37-18-8-16(12-30-13-18)22-9-19-20-10-24(35-5)25(36-6)11-23(20)31-14-21(19)26(29)33-22/h8-14,17H,7,15H2,1-6H3,(H2,29,33)(H,32,34)/t17-/m0/s1 |
| InChIKey | HMRQSRGVKJPPDS-KRWDZBQOSA-N |
| XLogP | 5.13 |
| TPSA | 130.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|