C38H35N6O4PS — CID 69171521
2-[5-[2-(diphenylphosphorylamino)-4-(1,3-thiazol-2-yl)butoxy]-3-pyridinyl]-8,9-dimethoxybenzo[f][2,7]naphthyridin-4-amine (PubChem CID 69171521) has the molecular formula C38H35N6O4PS and a molecular weight of 702.78 g/mol. Its IUPAC name is 2-[5-[2-(diphenylphosphorylamino)-4-(1,3-thiazol-2-yl)butoxy]-3-pyridinyl]-8,9-dimethoxybenzo[f][2,7]naphthyridin-4-amine.
| Compound Name | 2-[5-[2-(diphenylphosphorylamino)-4-(1,3-thiazol-2-yl)butoxy]-3-pyridinyl]-8,9-dimethoxybenzo[f][2,7]naphthyridin-4-amine |
|---|---|
| PubChem CID | 69171521 |
| Molecular Formula | C38H35N6O4PS |
| Molecular Weight | 702.78 g/mol |
| Exact Mass | 702.22 |
| IUPAC Name | 2-[5-[2-(diphenylphosphorylamino)-4-(1,3-thiazol-2-yl)butoxy]-3-pyridinyl]-8,9-dimethoxybenzo[f][2,7]naphthyridin-4-amine |
| SMILES | COc1cc2ncc3c(N)nc(-c4cncc(OCC(CCc5nccs5)NP(=O)(c5ccccc5)c5ccccc5)c4)cc3c2cc1OC |
| InChI | InChI=1S/C38H35N6O4PS/c1-46-35-19-31-30-18-33(43-38(39)32(30)23-42-34(31)20-36(35)47-2)25-17-27(22-40-21-25)48-24-26(13-14-37-41-15-16-50-37)44-49(45,28-9-5-3-6-10-28)29-11-7-4-8-12-29/h3-12,15-23,26H,13-14,24H2,1-2H3,(H2,39,43)(H,44,45) |
| InChIKey | UYBALDGYIKAXHA-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 134.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.78 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|