C24H20N6O3 — CID 69170042
2-[5-[(4-amino-2-pyridinyl)oxy]-3-pyridinyl]-8,9-dimethoxybenzo[f][2,7]naphthyridin-4-amine (PubChem CID 69170042) has the molecular formula C24H20N6O3 and a molecular weight of 440.46 g/mol. Its IUPAC name is 2-[5-[(4-amino-2-pyridinyl)oxy]-3-pyridinyl]-8,9-dimethoxybenzo[f][2,7]naphthyridin-4-amine.
| Compound Name | 2-[5-[(4-amino-2-pyridinyl)oxy]-3-pyridinyl]-8,9-dimethoxybenzo[f][2,7]naphthyridin-4-amine |
|---|---|
| PubChem CID | 69170042 |
| Molecular Formula | C24H20N6O3 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 2-[5-[(4-amino-2-pyridinyl)oxy]-3-pyridinyl]-8,9-dimethoxybenzo[f][2,7]naphthyridin-4-amine |
| SMILES | COc1cc2ncc3c(N)nc(-c4cncc(Oc5cc(N)ccn5)c4)cc3c2cc1OC |
| InChI | InChI=1S/C24H20N6O3/c1-31-21-8-17-16-7-19(30-24(26)18(16)12-29-20(17)9-22(21)32-2)13-5-15(11-27-10-13)33-23-6-14(25)3-4-28-23/h3-12H,1-2H3,(H2,25,28)(H2,26,30) |
| InChIKey | PNFIYLQAFWPMBP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 131.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|