C27H22N4O4 — CID 87721313
2-[2-[[5-(4-amino-8,9-dimethoxybenzo[c][2,7]naphthyridin-2-yl)-3-pyridinyl]oxy]phenyl]acetaldehyde (PubChem CID 87721313) has the molecular formula C27H22N4O4 and a molecular weight of 466.50 g/mol. Its IUPAC name is 2-[2-[[5-(4-amino-8,9-dimethoxybenzo[c][2,7]naphthyridin-2-yl)-3-pyridinyl]oxy]phenyl]acetaldehyde.
| Compound Name | 2-[2-[[5-(4-amino-8,9-dimethoxybenzo[c][2,7]naphthyridin-2-yl)-3-pyridinyl]oxy]phenyl]acetaldehyde |
|---|---|
| PubChem CID | 87721313 |
| Molecular Formula | C27H22N4O4 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 2-[2-[[5-(4-amino-8,9-dimethoxybenzo[c][2,7]naphthyridin-2-yl)-3-pyridinyl]oxy]phenyl]acetaldehyde |
| SMILES | COc1cc2ncc3c(N)nc(-c4cncc(Oc5ccccc5CC=O)c4)cc3c2cc1OC |
| InChI | InChI=1S/C27H22N4O4/c1-33-25-11-20-19-10-22(31-27(28)21(19)15-30-23(20)12-26(25)34-2)17-9-18(14-29-13-17)35-24-6-4-3-5-16(24)7-8-32/h3-6,8-15H,7H2,1-2H3,(H2,28,31) |
| InChIKey | PYHNDABNMACVCK-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 109.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|