About 1-[4-(4-amino-6,7-dimethoxyquinolin-2-yl)piperazin-1-yl]ethanone
1-[4-(4-amino-6,7-dimethoxyquinolin-2-yl)piperazin-1-yl]ethanone (PubChem CID 14068999) has the molecular formula C17H22N4O3
and a molecular weight of 330.39 g/mol. Its IUPAC name is 1-[4-(4-amino-6,7-dimethoxyquinolin-2-yl)piperazin-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-(4-amino-6,7-dimethoxyquinolin-2-yl)piperazin-1-yl]ethanone |
| PubChem CID | 14068999 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 1-[4-(4-amino-6,7-dimethoxyquinolin-2-yl)piperazin-1-yl]ethanone |
| SMILES | COc1cc2nc(N3CCN(C(C)=O)CC3)cc(N)c2cc1OC |
| InChI | InChI=1S/C17H22N4O3/c1-11(22)20-4-6-21(7-5-20)17-9-13(18)12-8-15(23-2)16(24-3)10-14(12)19-17/h8-10H,4-7H2,1-3H3,(H2,18,19) |
| InChIKey | SGSKYLGFEYUIRR-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[4-(4-amino-6,7-dimethoxyquinolin-2-yl)piperazin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(4-amino-6,7-dimethoxyquinolin-2-yl)piperazin-1-yl]ethanone?
The IUPAC name of 1-[4-(4-amino-6,7-dimethoxyquinolin-2-yl)piperazin-1-yl]ethanone (CID 14068999) is 1-[4-(4-amino-6,7-dimethoxyquinolin-2-yl)piperazin-1-yl]ethanone.
What is the SMILES notation for 1-[4-(4-amino-6,7-dimethoxyquinolin-2-yl)piperazin-1-yl]ethanone?
The canonical SMILES for 1-[4-(4-amino-6,7-dimethoxyquinolin-2-yl)piperazin-1-yl]ethanone is COc1cc2nc(N3CCN(C(C)=O)CC3)cc(N)c2cc1OC.
What is the InChIKey of 1-[4-(4-amino-6,7-dimethoxyquinolin-2-yl)piperazin-1-yl]ethanone?
The InChIKey is SGSKYLGFEYUIRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N4O3/c1-11(22)20-4-6-21(7-5-20)17-9-13(18)12-8-15(23-2)16(24-3)10-14(12)19-17/h8-10H,4-7H2,1-3H3,(H2,18,19).
What are the key properties of 1-[4-(4-amino-6,7-dimethoxyquinolin-2-yl)piperazin-1-yl]ethanone?
1-[4-(4-amino-6,7-dimethoxyquinolin-2-yl)piperazin-1-yl]ethanone has a molecular weight of 330.39 g/mol, XLogP of 1.50, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(4-amino-6,7-dimethoxyquinolin-2-yl)piperazin-1-yl]ethanone is sourced from PubChem (CID 14068999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).