C31H33N3O3 — CID 46091074
2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-N-(4-phenylbutyl)quinoline-4-carboxamide (PubChem CID 46091074) has the molecular formula C31H33N3O3 and a molecular weight of 495.62 g/mol. Its IUPAC name is 2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-N-(4-phenylbutyl)quinoline-4-carboxamide.
| Compound Name | 2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-N-(4-phenylbutyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 46091074 |
| Molecular Formula | C31H33N3O3 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | 2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-N-(4-phenylbutyl)quinoline-4-carboxamide |
| SMILES | COc1cc2c(cc1OC)CN(c1cc(C(=O)NCCCCc3ccccc3)c3ccccc3n1)CC2 |
| InChI | InChI=1S/C31H33N3O3/c1-36-28-18-23-15-17-34(21-24(23)19-29(28)37-2)30-20-26(25-13-6-7-14-27(25)33-30)31(35)32-16-9-8-12-22-10-4-3-5-11-22/h3-7,10-11,13-14,18-20H,8-9,12,15-17,21H2,1-2H3,(H,32,35) |
| InChIKey | KFIWYDLXPKSSEZ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|