C27H31ClN4O3S — CID 4618913
N-butyl-3-[[4-chloro-6-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-yl]sulfanylmethyl]benzamide (PubChem CID 4618913) has the molecular formula C27H31ClN4O3S and a molecular weight of 527.09 g/mol. Its IUPAC name is N-butyl-3-[[4-chloro-6-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-yl]sulfanylmethyl]benzamide.
| Compound Name | N-butyl-3-[[4-chloro-6-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-yl]sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 4618913 |
| Molecular Formula | C27H31ClN4O3S |
| Molecular Weight | 527.09 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | N-butyl-3-[[4-chloro-6-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-yl]sulfanylmethyl]benzamide |
| SMILES | CCCCNC(=O)c1cccc(CSc2nc(Cl)cc(N3CCc4cc(OC)c(OC)cc4C3)n2)c1 |
| InChI | InChI=1S/C27H31ClN4O3S/c1-4-5-10-29-26(33)20-8-6-7-18(12-20)17-36-27-30-24(28)15-25(31-27)32-11-9-19-13-22(34-2)23(35-3)14-21(19)16-32/h6-8,12-15H,4-5,9-11,16-17H2,1-3H3,(H,29,33) |
| InChIKey | VLEQXTYEBGPLCC-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.09 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|