C26H30ClN5OS — CID 3901694
4-[[4-(4-benzylpiperazin-1-yl)-6-chloropyrimidin-2-yl]sulfanylmethyl]-N-propylbenzamide (PubChem CID 3901694) has the molecular formula C26H30ClN5OS and a molecular weight of 496.08 g/mol. Its IUPAC name is 4-[[4-(4-benzylpiperazin-1-yl)-6-chloropyrimidin-2-yl]sulfanylmethyl]-N-propylbenzamide.
| Compound Name | 4-[[4-(4-benzylpiperazin-1-yl)-6-chloropyrimidin-2-yl]sulfanylmethyl]-N-propylbenzamide |
|---|---|
| PubChem CID | 3901694 |
| Molecular Formula | C26H30ClN5OS |
| Molecular Weight | 496.08 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | 4-[[4-(4-benzylpiperazin-1-yl)-6-chloropyrimidin-2-yl]sulfanylmethyl]-N-propylbenzamide |
| SMILES | CCCNC(=O)c1ccc(CSc2nc(Cl)cc(N3CCN(Cc4ccccc4)CC3)n2)cc1 |
| InChI | InChI=1S/C26H30ClN5OS/c1-2-12-28-25(33)22-10-8-21(9-11-22)19-34-26-29-23(27)17-24(30-26)32-15-13-31(14-16-32)18-20-6-4-3-5-7-20/h3-11,17H,2,12-16,18-19H2,1H3,(H,28,33) |
| InChIKey | HYKUPOPXHSVLEE-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.08 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |