C25H28ClN5OS — CID 42754398
N-benzyl-4-[[4-chloro-6-(4-ethylpiperazin-1-yl)pyrimidin-2-yl]sulfanylmethyl]benzamide (PubChem CID 42754398) has the molecular formula C25H28ClN5OS and a molecular weight of 482.05 g/mol. Its IUPAC name is N-benzyl-4-[[4-chloro-6-(4-ethylpiperazin-1-yl)pyrimidin-2-yl]sulfanylmethyl]benzamide.
| Compound Name | N-benzyl-4-[[4-chloro-6-(4-ethylpiperazin-1-yl)pyrimidin-2-yl]sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 42754398 |
| Molecular Formula | C25H28ClN5OS |
| Molecular Weight | 482.05 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | N-benzyl-4-[[4-chloro-6-(4-ethylpiperazin-1-yl)pyrimidin-2-yl]sulfanylmethyl]benzamide |
| SMILES | CCN1CCN(c2cc(Cl)nc(SCc3ccc(C(=O)NCc4ccccc4)cc3)n2)CC1 |
| InChI | InChI=1S/C25H28ClN5OS/c1-2-30-12-14-31(15-13-30)23-16-22(26)28-25(29-23)33-18-20-8-10-21(11-9-20)24(32)27-17-19-6-4-3-5-7-19/h3-11,16H,2,12-15,17-18H2,1H3,(H,27,32) |
| InChIKey | OTVCMWOLVYQXCJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.05 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |